EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12FNO3 |
| Net Charge | 0 |
| Average Mass | 285.274 |
| Monoisotopic Mass | 285.08012 |
| SMILES | C[C@H](C(=O)O)c1ccc2oc(-c3ccc(F)cc3)nc2c1 |
| InChI | InChI=1S/C16H12FNO3/c1-9(16(19)20)11-4-7-14-13(8-11)18-15(21-14)10-2-5-12(17)6-3-10/h2-9H,1H3,(H,19,20)/t9-/m0/s1 |
| InChIKey | ARPYQKTVRGFPIS-VIFPVBQESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | protein kinase C agonist An agonist that selectively binds to and activates a protein kinase C receptor hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. |
| Applications: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. antirheumatic drug A drug used to treat rheumatoid arthritis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flunoxaprofen (CHEBI:76154) has functional parent propionic acid (CHEBI:30768) |
| flunoxaprofen (CHEBI:76154) has role antirheumatic drug (CHEBI:35842) |
| flunoxaprofen (CHEBI:76154) has role hepatotoxic agent (CHEBI:50908) |
| flunoxaprofen (CHEBI:76154) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| flunoxaprofen (CHEBI:76154) has role protein kinase C agonist (CHEBI:64018) |
| flunoxaprofen (CHEBI:76154) is a 1,3-benzoxazoles (CHEBI:51548) |
| flunoxaprofen (CHEBI:76154) is a monocarboxylic acid (CHEBI:25384) |
| flunoxaprofen (CHEBI:76154) is a organofluorine compound (CHEBI:37143) |
| IUPAC Name |
|---|
| (2S)-2-[2-(4-fluorophenyl)-1,3-benzoxazol-5-yl]propanoic acid |
| INNs | Source |
|---|---|
| flunoxaprofen | KEGG DRUG |
| flunoxaprofenum | ChemIDplus |
| flunoxaprofeno | ChemIDplus |
| flunoxaprofène | WHO MedNet |
| Synonyms | Source |
|---|---|
| (S)-2-(4-Fluorophenyl)-alpha-methyl-5-benzoxazoleacetic acid | ChemIDplus |
| (+)-2-(p-Fluorophenyl)-alpha-methyl-5-benzoxazoleacetic acid | ChemIDplus |
| (S)-(+)-Flunoxaprofen | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D07219 | KEGG DRUG |
| Flunoxaprofen | Wikipedia |
| 1203 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6871045 | Reaxys |
| CAS:66934-18-7 | KEGG DRUG |
| CAS:66934-18-7 | ChemIDplus |
| Citations |
|---|