EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H11F3N2O2.C7H17NO5 |
| Net Charge | 0 |
| Average Mass | 491.463 |
| Monoisotopic Mass | 491.18793 |
| SMILES | CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.Cc1c(Nc2ncccc2C(=O)O)cccc1C(F)(F)F |
| InChI | InChI=1S/C14H11F3N2O2.C7H17NO5/c1-8-10(14(15,16)17)5-2-6-11(8)19-12-9(13(20)21)4-3-7-18-12;1-8-2-4(10)6(12)7(13)5(11)3-9/h2-7H,1H3,(H,18,19)(H,20,21);4-13H,2-3H2,1H3/t;4-,5+,6+,7+/m.0/s1 |
| InChIKey | MGCCHNLNRBULBU-WZTVWXICSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor A compound or agent that combines with cyclooxygenases (EC 1.14.99.1) and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of icosanoids, prostaglandins, and thromboxanes. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flunixin meglumine (CHEBI:76144) has part flunixin(1−) (CHEBI:76153) |
| flunixin meglumine (CHEBI:76144) has role antipyretic (CHEBI:35493) |
| flunixin meglumine (CHEBI:76144) has role EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor (CHEBI:35544) |
| flunixin meglumine (CHEBI:76144) has role non-narcotic analgesic (CHEBI:35481) |
| flunixin meglumine (CHEBI:76144) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| flunixin meglumine (CHEBI:76144) is a organoammonium salt (CHEBI:46850) |
| IUPAC Names |
|---|
| 1-deoxy-1-(methylazaniumyl)-D-glucitol 2-{[2-methyl-3-(trifluoromethyl)phenyl]amino}nicotinate |
| 2-{[2-methyl-3-(trifluoromethyl)phenyl]amino}nicotinic acid—1-deoxy-1-(methylamino)-D-glucitol (1/1) |
| Synonyms | Source |
|---|---|
| 1-Deoxy-1-(methylamino)-D-glucitol 2-(2-methyl-3-(perfluoromethyl)anilino)nicotinate | ChemIDplus |
| Flumeglumine | ChemIDplus |
| Flunixin meglumine | ChEMBL |
| Flunixin meglumine salt | ChEMBL |
| Flunixin N-methylglucanine | ChemIDplus |
| Flunixin-S | ChemIDplus |
| Brand Name | Source |
|---|---|
| Banamine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D04216 | KEGG DRUG |
| Flunixin | Wikipedia |
| US2008153885 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8888607 | Reaxys |
| CAS:42461-84-7 | ChemIDplus |
| CAS:42461-84-7 | KEGG DRUG |
| Citations |
|---|