EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24N3O9 |
| Net Charge | 0 |
| Average Mass | 390.369 |
| Monoisotopic Mass | 390.15125 |
| SMILES | *[C@H]1O[C@H](C(N)=O)[C@H](O[C@@H]2O[C@H](C)[C@@H](NC([H])=O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1NC(C)=O |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-D-QuiN4Fm-(1→4)-α-D-GalNAcAN-yl group (CHEBI:76135) has role epitope (CHEBI:53000) |
| β-D-QuiN4Fm-(1→4)-α-D-GalNAcAN-yl group (CHEBI:76135) is a glycosyl group (CHEBI:24403) |
| Synonyms | Source |
|---|---|
| N62epitope | ChEBI |
| β-D-QuipN4Fm-(1→4)-α-D-GalpNAcAN-yl | JCBN |