EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22N2O7 |
| Net Charge | 0 |
| Average Mass | 366.370 |
| Monoisotopic Mass | 366.14270 |
| SMILES | N[C@@H](Cc1cn([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c2ccccc12)C(=O)O |
| InChI | InChI=1S/C17H22N2O7/c18-10(17(24)25)5-8-6-19(11-4-2-1-3-9(8)11)16-15(23)14(22)13(21)12(7-20)26-16/h1-4,6,10,12-16,20-23H,5,7,18H2,(H,24,25)/t10-,12+,13+,14-,15+,16+/m0/s1 |
| InChIKey | ZHBHZDMTVVJASV-JOSVURMMSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tryptophan N-glucoside (CHEBI:76121) has functional parent β-D-glucose (CHEBI:15903) |
| tryptophan N-glucoside (CHEBI:76121) has role metabolite (CHEBI:25212) |
| tryptophan N-glucoside (CHEBI:76121) is a N-glycosyl compound (CHEBI:21731) |
| tryptophan N-glucoside (CHEBI:76121) is a L-tryptophan derivative (CHEBI:47994) |
| tryptophan N-glucoside (CHEBI:76121) is a monosaccharide derivative (CHEBI:63367) |
| tryptophan N-glucoside (CHEBI:76121) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| IUPAC Name |
|---|
| 1-β-D-glucopyranosyl-L-tryptophan |
| Synonyms | Source |
|---|---|
| L-tryptophan N-glucopyranoside | ChEBI |
| L-tryptophan N-glucoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8802823 | Reaxys |