EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12ClNO3 |
| Net Charge | 0 |
| Average Mass | 301.729 |
| Monoisotopic Mass | 301.05057 |
| SMILES | CC(C(=O)O)c1ccc2oc(-c3ccc(Cl)cc3)nc2c1 |
| InChI | InChI=1S/C16H12ClNO3/c1-9(16(19)20)11-4-7-14-13(8-11)18-15(21-14)10-2-5-12(17)6-3-10/h2-9H,1H3,(H,19,20) |
| InChIKey | MITFXPHMIHQXPI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor A lipoxygenase inhibitor that interferes with the action of arachidonate 5-lipoxygenase (EC 1.13.11.34). hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. protein kinase C agonist An agonist that selectively binds to and activates a protein kinase C receptor nephrotoxic agent A role played by any chemical compound (natural or synthetic) exhibiting itself through the ability to induce damage to the kidneys. |
| Applications: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. antipsoriatic A drug used to treat psoriasis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benoxaprofen (CHEBI:76114) has functional parent propionic acid (CHEBI:30768) |
| benoxaprofen (CHEBI:76114) has role antipsoriatic (CHEBI:50748) |
| benoxaprofen (CHEBI:76114) has role antipyretic (CHEBI:35493) |
| benoxaprofen (CHEBI:76114) has role EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor (CHEBI:64964) |
| benoxaprofen (CHEBI:76114) has role hepatotoxic agent (CHEBI:50908) |
| benoxaprofen (CHEBI:76114) has role nephrotoxic agent (CHEBI:50909) |
| benoxaprofen (CHEBI:76114) has role non-narcotic analgesic (CHEBI:35481) |
| benoxaprofen (CHEBI:76114) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| benoxaprofen (CHEBI:76114) has role protein kinase C agonist (CHEBI:64018) |
| benoxaprofen (CHEBI:76114) is a 1,3-benzoxazoles (CHEBI:51548) |
| benoxaprofen (CHEBI:76114) is a monocarboxylic acid (CHEBI:25384) |
| benoxaprofen (CHEBI:76114) is a monochlorobenzenes (CHEBI:83403) |
| IUPAC Name |
|---|
| 2-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]propanoic acid |
| INNs | Source |
|---|---|
| benoxaprofen | KEGG DRUG |
| benoxaprofene | DrugBank |
| benoxaprofeno | DrugBank |
| benoxaprofenum | DrugBank |
| Synonyms | Source |
|---|---|
| (1)-2-(4-Chlorophenyl)benzoxazole-5-propionic acid | ChemIDplus |
| 2-(4-Chlorophenyl)-alpha-methyl-5-benzoxazoleacetic acid | ChemIDplus |
| 2-(4-chlorophenyl)-α-methyl-5-benzoxazoleacetic acid | NIST Chemistry WebBook |
| 2-(p-chlorophenyl)-α-methyl-5-benzoxazoleacetic acid | NIST Chemistry WebBook |
| (±)-benoxaprofen | ChemIDplus |
| DL-benoxaprofen | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 311 | DrugCentral |
| Benoxaprofen | Wikipedia |
| D03080 | KEGG DRUG |
| DB04812 | DrugBank |
| DE2324443 | Patent |
| US3912748 | Patent |
| US4391814 | Patent |
| US6338855 | Patent |
| WO2008020270 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1085080 | Reaxys |
| CAS:51234-28-7 | NIST Chemistry WebBook |
| CAS:51234-28-7 | KEGG DRUG |
| CAS:51234-28-7 | ChemIDplus |
| Citations |
|---|