EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18O6 |
| Net Charge | 0 |
| Average Mass | 306.314 |
| Monoisotopic Mass | 306.11034 |
| SMILES | OC[C@H]1O[C@@H](Oc2cccc3ccccc23)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H18O6/c17-8-12-13(18)14(19)15(20)16(22-12)21-11-7-3-5-9-4-1-2-6-10(9)11/h1-7,12-20H,8H2/t12-,13-,14+,15-,16-/m1/s1 |
| InChIKey | CVAOQMBKGUKOIZ-IBEHDNSVSA-N |
| Roles Classification |
|---|
| Chemical Role: | electron donor A molecular entity that can transfer an electron to another molecular entity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| beta-D-glucosyl-1-hydroxynaphthol (CHEBI:761002) is a monosaccharide derivative (CHEBI:63367) |
| beta-D-glucosyl-1-hydroxynaphthol (CHEBI:761002) is a naphthol (CHEBI:35682) |
| beta-D-glucosyl-1-hydroxynaphthol (CHEBI:761002) is a β-D-glucoside (CHEBI:22798) |
| UniProt Name | Source |
|---|---|
| beta-D-glucosyl-1-hydroxynaphthol | UniProt |
| Citations |
|---|