EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H22NO2 |
| Net Charge | +1 |
| Average Mass | 224.324 |
| Monoisotopic Mass | 224.16451 |
| SMILES | C/C=C(\C)C(=O)O[C@H]1C[C@H]2CC[C@@H](C1)[NH+]2C |
| InChI | InChI=1S/C13H21NO2/c1-4-9(2)13(15)16-12-7-10-5-6-11(8-12)14(10)3/h4,10-12H,5-8H2,1-3H3/p+1/b9-4+/t10-,11+,12+ |
| InChIKey | UVHGSMZRSVGWDJ-LKQNJMEQSA-O |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3α-tigloyloxytropane (CHEBI:760939) has functional parent tropinium (CHEBI:57554) |
| 3α-tigloyloxytropane (CHEBI:760939) is a tropane alkaloid (CHEBI:37332) |
| Incoming Relation(s) |
| 3β-tigloyloxytropane (CHEBI:760940) is enantiomer of 3α-tigloyloxytropane (CHEBI:760939) |
| UniProt Name | Source |
|---|---|
| 3α-tigloyloxytropane | UniProt |