EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18NO2 |
| Net Charge | +1 |
| Average Mass | 184.259 |
| Monoisotopic Mass | 184.13321 |
| SMILES | CC(=O)O[C@@H]1C[C@H]2CC[C@@H](C1)[NH+]2C |
| InChI | InChI=1S/C10H17NO2/c1-7(12)13-10-5-8-3-4-9(6-10)11(8)2/h8-10H,3-6H2,1-2H3/p+1/t8-,9+,10- |
| InChIKey | MDIDMOWWLBGYPG-ILWJIGKKSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-acetylpseudotropine (CHEBI:760937) is a O-acylpseudotropine (CHEBI:52657) |
| O-acetylpseudotropine (CHEBI:760937) is a acetate ester (CHEBI:47622) |
| O-acetylpseudotropine (CHEBI:760937) is enantiomer of O-acetyltropine (CHEBI:31170) |
| O-acetylpseudotropine (CHEBI:760937) is enantiomer of O-acetyltropine(1+) (CHEBI:760938) |
| UniProt Name | Source |
|---|---|
| O-acetylpseudotropine | UniProt |