EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H27N2O2 |
| Net Charge | +1 |
| Average Mass | 279.404 |
| Monoisotopic Mass | 279.20670 |
| SMILES | CC[NH+](CC)CC(C)(C)COC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C16H26N2O2/c1-5-18(6-2)11-16(3,4)12-20-15(19)13-7-9-14(17)10-8-13/h7-10H,5-6,11-12,17H2,1-4H3/p+1 |
| InChIKey | OWQIUQKMMPDHQQ-UHFFFAOYSA-O |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dimethocaine(1+) (CHEBI:760929) is a substituted aniline (CHEBI:48975) |
| dimethocaine(1+) (CHEBI:760929) is a tertiary ammonium ion (CHEBI:137982) |
| dimethocaine(1+) (CHEBI:760929) is conjugate acid of dimethocaine (CHEBI:135154) |
| UniProt Name | Source |
|---|---|
| dimethocaine | UniProt |