EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24NO4 |
| Net Charge | +1 |
| Average Mass | 342.415 |
| Monoisotopic Mass | 342.16998 |
| SMILES | [H][C@@]12CC=C(OC(C)=O)[C@]3([H])Oc4c(OC)ccc5c4[C@]13CC[NH+](C)[C@]2([H])C5 |
| InChI | InChI=1S/C20H23NO4/c1-11(22)24-16-7-5-13-14-10-12-4-6-15(23-3)18-17(12)20(13,19(16)25-18)8-9-21(14)2/h4,6-7,13-14,19H,5,8-10H2,1-3H3/p+1/t13-,14+,19-,20-/m0/s1 |
| InChIKey | RRJQTGHQFYTZOW-ILWKUFEGSA-O |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thebacon(+1) (CHEBI:760926) is a acetate ester (CHEBI:47622) |
| thebacon(+1) (CHEBI:760926) is a aromatic ether (CHEBI:35618) |
| thebacon(+1) (CHEBI:760926) is a cyclic ether (CHEBI:37407) |
| thebacon(+1) (CHEBI:760926) is a morphinane alkaloid (CHEBI:25418) |
| thebacon(+1) (CHEBI:760926) is conjugate acid of thebacon (CHEBI:135449) |
| UniProt Name | Source |
|---|---|
| thebacon | UniProt |