EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:760925 - ethylphenidate(1+)
| Formula | C15H22NO2 |
| Net Charge | +1 |
| Average Mass | 248.346 |
| Monoisotopic Mass | 248.16451 |
| SMILES | CCOC(=O)C(c1ccccc1)C1CCCC[NH2+]1 |
| InChI | InChI=1S/C15H21NO2/c1-2-18-15(17)14(12-8-4-3-5-9-12)13-10-6-7-11-16-13/h3-5,8-9,13-14,16H,2,6-7,10-11H2,1H3/p+1 |
| InChIKey | AIVSIRYZIBXTMM-UHFFFAOYSA-O |
| Roles Classification |
|---|
| Biological Role: | dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. |
| Application: | dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethylphenidate(1+) (CHEBI:760925) has role dopamine uptake inhibitor (CHEBI:51039) |
| ethylphenidate(1+) (CHEBI:760925) is a ethyl ester (CHEBI:23990) |
| ethylphenidate(1+) (CHEBI:760925) is a piperidinium ion (CHEBI:48633) |
| UniProt Name | Source |
|---|---|
| ethylphenidate | UniProt |