EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H13NO2 |
| Net Charge | 0 |
| Average Mass | 239.274 |
| Monoisotopic Mass | 239.09463 |
| SMILES | CC(=O)ONc1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C15H13NO2/c1-10(17)18-16-13-6-7-15-12(9-13)8-11-4-2-3-5-14(11)15/h2-7,9,16H,8H2,1H3 |
| InChIKey | DAJPHRKDAWYAJZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetoxy-2-aminofluorene (CHEBI:760880) has functional parent N-hydroxy-2-aminofluorene (CHEBI:760879) |
| N-acetoxy-2-aminofluorene (CHEBI:760880) is a acetate ester (CHEBI:47622) |
| N-acetoxy-2-aminofluorene (CHEBI:760880) is a fluorenes (CHEBI:24059) |
| UniProt Name | Source |
|---|---|
| N-acetoxy-2-aminofluorene | UniProt |