EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H15N |
| Net Charge | 0 |
| Average Mass | 197.281 |
| Monoisotopic Mass | 197.12045 |
| SMILES | Cc1cc(-c2ccccc2C)ccc1N |
| InChI | InChI=1S/C14H15N/c1-10-5-3-4-6-13(10)12-7-8-14(15)11(2)9-12/h3-9H,15H2,1-2H3 |
| InChIKey | HSQVHYANHDSFFI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,2'-dimethyl-4-aminobiphenyl (CHEBI:760877) has role carcinogenic agent (CHEBI:50903) |
| 3,2'-dimethyl-4-aminobiphenyl (CHEBI:760877) is a aminobiphenyl (CHEBI:22496) |
| Incoming Relation(s) |
| N-(2′,3-dimethyl[1,1′-biphenyl]-4-yl)acetamide (CHEBI:760878) has functional parent 3,2'-dimethyl-4-aminobiphenyl (CHEBI:760877) |
| Synonyms | Source |
|---|---|
| 2',3-dimethyl-4-aminobiphenyl | SUBMITTER |
| 3,2'-Dmab | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 3,2'-dimethyl-4-aminobiphenyl | UniProt |