EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H13F5N6O2S |
| Net Charge | 0 |
| Average Mass | 460.388 |
| Monoisotopic Mass | 460.07409 |
| SMILES | CCS(=O)(=O)c1cc2c(cnn2C(F)F)nc1-c1nc2cc(C(F)(F)F)cnc2n1C |
| InChI | InChI=1S/C17H13F5N6O2S/c1-3-31(29,30)12-5-11-10(7-24-28(11)16(18)19)25-13(12)15-26-9-4-8(17(20,21)22)6-23-14(9)27(15)2/h4-7,16H,3H2,1-2H3 |
| InChIKey | VIXLUCDSTJGHOW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dipyrisulfyl (CHEBI:760874) is a imidazopyridine (CHEBI:46908) |
| dipyrisulfyl (CHEBI:760874) is a organofluorine insecticide (CHEBI:38804) |
| dipyrisulfyl (CHEBI:760874) is a pyrazolopyridine (CHEBI:46699) |
| dipyrisulfyl (CHEBI:760874) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| 1-(difluoromethyl)-6-(ethylsulfonyl)-5-[3-methyl-6-(trifluoromethyl)-3H-imidazo[4,5-b]pyridin-2-yl]-1H-pyrazolo[4,3-b]pyridine |
| Synonyms | Source |
|---|---|
| 1-(difluoromethyl)-6-(ethanesulfonyl)-5-[3-methyl-6-(trifluoromethyl)-3H-imidazo[4,5-b]pyridin-2-yl]-1H-pyrazolo[4,3-b]pyridine | Alan Wood's Pesticides |
| 1-(difluoromethyl)-6-(ethylsulfonyl)-5-(3-methyl-6-(trifluoromethyl)-3H-imidazo[4,5-b]pyridin-2-yl)-1H-pyrazolo[4,3-b]pyridine | Alan Wood's Pesticides |
| dipyrisulfyl | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| dipyrisulfyl | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:66457911 | Reaxys |
| CAS:3104793-78-1 | Alan Wood's Pesticides |