EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H23N5O16P3 |
| Net Charge | +1 |
| Average Mass | 622.290 |
| Monoisotopic Mass | 622.03472 |
| SMILES | Nc1c2ncn3c2nc[n+]1[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H]3[C@H](OP(=O)(O)O)[C@@H]2O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H22N5O16P3/c16-12-7-13-18-4-19(12)14-10(23)8(21)5(33-14)1-31-38(27,28)36-39(29,30)32-2-6-9(22)11(35-37(24,25)26)15(34-6)20(13)3-17-7/h3-6,8-11,14-16,21-23H,1-2H2,(H4,24,25,26,27,28,29,30)/p+1/t5-,6-,8-,9-,10-,11-,14-,15-/m1/s1 |
| InChIKey | FUQPZSKOSARDNY-KEOHHSTQSA-O |
| Roles Classification |
|---|
| Biological Roles: | calcium channel agonist Agents that increase calcium influx into calcium channels of excitable tissues. signalling molecule A molecular messenger in which the molecule is specifically involved in transmitting information between cells. Such molecules are released from the cell sending the signal, cross over the gap between cells by diffusion, and interact with specific receptors in another cell, triggering a response in that cell by activating a series of enzyme controlled reactions which lead to changes inside the cell. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2'-phospho-cyclic ADP-ribose (CHEBI:76081) has functional parent cyclic ADP-β-D-ribose (CHEBI:31445) |
| 2'-phospho-cyclic ADP-ribose (CHEBI:76081) has role calcium channel agonist (CHEBI:38807) |
| 2'-phospho-cyclic ADP-ribose (CHEBI:76081) has role metabolite (CHEBI:25212) |
| 2'-phospho-cyclic ADP-ribose (CHEBI:76081) has role signalling molecule (CHEBI:62488) |
| 2'-phospho-cyclic ADP-ribose (CHEBI:76081) is a cyclic purine nucleotide (CHEBI:36982) |
| 2'-phospho-cyclic ADP-ribose (CHEBI:76081) is a nucleotide-sugar (CHEBI:25609) |
| 2'-phospho-cyclic ADP-ribose (CHEBI:76081) is conjugate acid of 2'-phospho-cyclic ADP-ribose(3−) (CHEBI:75970) |
| Incoming Relation(s) |
| 2'-phospho-cyclic ADP-ribose(3−) (CHEBI:75970) is conjugate base of 2'-phospho-cyclic ADP-ribose (CHEBI:76081) |
| Synonyms | Source |
|---|---|
| cADPRP | MetaCyc |
| cyclic adenosine diphosphate ribose phosphate | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| CPD-15008 | MetaCyc |
| Citations |
|---|