EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H23N5O7S |
| Net Charge | 0 |
| Average Mass | 525.543 |
| Monoisotopic Mass | 525.13182 |
| SMILES | NC(=O)c1nn(-c2ccc(OS(=O)(=O)O)cc2)c2c1CCN(c1ccc(N3CCCCC3=O)cc1)C2=O |
| InChI | InChI=1S/C24H23N5O7S/c25-23(31)21-19-12-14-28(16-6-4-15(5-7-16)27-13-2-1-3-20(27)30)24(32)22(19)29(26-21)17-8-10-18(11-9-17)36-37(33,34)35/h4-11H,1-3,12-14H2,(H2,25,31)(H,33,34,35) |
| InChIKey | HRIFVOGTDGFZKP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000118) | PubMed (18832478) |
| Roles Classification |
|---|
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-demethyl apixaban sulfate (CHEBI:760768) has role drug metabolite (CHEBI:49103) |
| O-demethyl apixaban sulfate (CHEBI:760768) has role human xenobiotic metabolite (CHEBI:76967) |
| O-demethyl apixaban sulfate (CHEBI:760768) is a aryl sulfate (CHEBI:37919) |
| O-demethyl apixaban sulfate (CHEBI:760768) is a piperidones (CHEBI:48589) |
| O-demethyl apixaban sulfate (CHEBI:760768) is a primary carboxamide (CHEBI:140324) |
| O-demethyl apixaban sulfate (CHEBI:760768) is a pyrazolopyridine (CHEBI:46699) |
| IUPAC Name |
|---|
| 4-{3-carbamoyl-7-oxo-6-[4-(2-oxopiperidin-1-yl)phenyl]-4,5,6,7-tetrahydro-1H-pyrazolo[3,4-c]pyridin-1-yl}phenyl hydrogen sulfate |
| Synonyms | Source |
|---|---|
| apixaban impurity 242 | ChEBI |
| apixaban (M1) | PubChem Compound |
| apixaban (metabolite M1) | PubChem Compound |
| O-desmethyl apixaban sulfate | ChEBI |
| O-desmethylapixaban-sulfate (M1) | PubChem Compound |
| Manual Xrefs | Databases |
|---|---|
| HMDB0259525 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:1118765-14-2 | ChEBI |
| Citations |
|---|