EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:760760 - 7β-aminodeacetoxycephalosporanate
| Formula | C8H9N2O3S |
| Net Charge | -1 |
| Average Mass | 213.238 |
| Monoisotopic Mass | 213.03394 |
| SMILES | [H][C@]12SCC(C)=C(C(=O)[O-])N1C(=O)[C@H]2N |
| InChI | InChI=1S/C8H10N2O3S/c1-3-2-14-7-4(9)6(11)10(7)5(3)8(12)13/h4,7H,2,9H2,1H3,(H,12,13)/p-1/t4-,7-/m1/s1 |
| InChIKey | NVIAYEIXYQCDAN-CLZZGJSISA-M |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7β-aminodeacetoxycephalosporanate (CHEBI:760760) has role antimicrobial agent (CHEBI:33281) |
| 7β-aminodeacetoxycephalosporanate (CHEBI:760760) is a cephalosporin (CHEBI:23066) |
| 7β-aminodeacetoxycephalosporanate (CHEBI:760760) is a monocarboxylic acid anion (CHEBI:35757) |
| 7β-aminodeacetoxycephalosporanate (CHEBI:760760) is conjugate base of 7β-aminodeacetoxycephalosporanic acid (CHEBI:64984) |
| Synonym | Source |
|---|---|
| 7-amino-3-methyl-3-cephem-4-carboxylate | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 7β-aminodeacetoxycephalosporanate | UniProt |