EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H9N5O |
| Net Charge | 0 |
| Average Mass | 179.183 |
| Monoisotopic Mass | 179.08071 |
| SMILES | CN(C)c1nc(=O)c2ncnc2n1 |
| InChI | InChI=1S/C7H9N5O/c1-12(2)7-10-5-4(6(13)11-7)8-3-9-5/h3H,1-2H3,(H2,8,9,10,11,13) |
| InChIKey | XMSMHKMPBNTBOD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N(2),N(2)-dimethylguanine (CHEBI:760689) is a oxopurine (CHEBI:25810) |
| N(2),N(2)-dimethylguanine (CHEBI:760689) is a tertiary amine (CHEBI:32876) |
| N(2),N(2)-dimethylguanine (CHEBI:760689) is tautomer of 2-dimethylamino-6-hydroxypurine (CHEBI:190990) |
| UniProt Name | Source |
|---|---|
| N(2),N(2)-dimethylguanine | UniProt |
| Citations |
|---|