EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:760670 - N,N-diacetylputrescine
| Formula | C8H16N2O2 |
| Net Charge | 0 |
| Average Mass | 172.228 |
| Monoisotopic Mass | 172.12118 |
| SMILES | CC(=O)NCCCCNC(C)=O |
| InChI | InChI=1S/C8H16N2O2/c1-7(11)9-5-3-4-6-10-8(2)12/h3-6H2,1-2H3,(H,9,11)(H,10,12) |
| InChIKey | KFBMJMUYUQWEOA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N-diacetylputrescine (CHEBI:760670) is a N-substituted putrescine (CHEBI:26406) |
| N,N-diacetylputrescine (CHEBI:760670) is a acetamides (CHEBI:22160) |
| UniProt Name | Source |
|---|---|
| N(1),N(4)-diacetylputrescine | UniProt |
| Citations |
|---|