EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H18Cl2F7N3O3 |
| Net Charge | 0 |
| Average Mass | 588.307 |
| Monoisotopic Mass | 587.06134 |
| SMILES | Cc1cc(C2=NO[C@@](c3cc(Cl)c(F)c(Cl)c3)(C(F)(F)F)C2)ccc1C(=O)N[C@H](C)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C23H18Cl2F7N3O3/c1-10-5-12(3-4-14(10)20(37)34-11(2)19(36)33-9-22(27,28)29)17-8-21(38-35-17,23(30,31)32)13-6-15(24)18(26)16(25)7-13/h3-7,11H,8-9H2,1-2H3,(H,33,36)(H,34,37)/t11-,21+/m1/s1 |
| InChIKey | GUBFWLUOEUJOJK-FIKIJFGZSA-N |
| Roles Classification |
|---|
| Application: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoxalanam (CHEBI:760660) has role insecticide (CHEBI:24852) |
| isoxalanam (CHEBI:760660) is a dichlorobenzene (CHEBI:23697) |
| isoxalanam (CHEBI:760660) is a isoxazoline (CHEBI:87553) |
| isoxalanam (CHEBI:760660) is a monofluorobenzenes (CHEBI:83575) |
| isoxalanam (CHEBI:760660) is a organofluorine compound (CHEBI:37143) |
| isoxalanam (CHEBI:760660) is a secondary amide (CHEBI:33257) |
| isoxalanam (CHEBI:760660) is a toluenes (CHEBI:27024) |
| isoxalanam (CHEBI:760660) is a unclassifieds (CHEBI:27189) |
| IUPAC Name |
|---|
| 4-[(5S)-5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4,5-dihydro-1,2-oxazol-3-yl]-2-methyl-N-{(2R)-1-oxo-1-[(2,2,2-trifluoroethyl)amino]propan-2-yl}benzamide |
| Synonyms | Source |
|---|---|
| 4-[(5S)-5-(3,5-dichloro-4-fluorophenyl)-4,5-dihydro-5-(trifluoromethyl)-3-isoxazolyl]-2-methyl-N-[(1R)-1-methyl-2-oxo-2-[(2,2,2-trifluoroethyl)amino]ethyl]benzamide | Alan Wood's Pesticides |
| 4-[(5S)-5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4,5-dihydro-1,2-isoxazol-3-yl]-2-methyl-N-[(2R)-1-oxo-1-((2,2,2-trifluoroethyl)amino)propan-2-yl]benzamide | Alan Wood's Pesticides |
| 4-[(5S)-5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4,5-dihydroisoxazol-3-yl]-2-methyl-N-{(1R)-1-methyl-2-oxo-2-[(2,2,2-trifluoroethyl)amino]ethyl}benzamide | Alan Wood's Pesticides |
| isoxalaname | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| isoxalanam | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:63505163 | Reaxys |
| CAS:3085252-12-3 | Alan Wood's Pesticides |