EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H23ClO4S2 |
| Net Charge | 0 |
| Average Mass | 414.976 |
| Monoisotopic Mass | 414.07263 |
| SMILES | COc1cc(C(SCCO)SCCO)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H23ClO4S2/c1-23-18-12-15(19(25-10-8-21)26-11-9-22)4-7-17(18)24-13-14-2-5-16(20)6-3-14/h2-7,12,19,21-22H,8-11,13H2,1H3 |
| InChIKey | RXBFIIHCXPPUHA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vanisulfane (CHEBI:760656) has role antiviral agent (CHEBI:22587) |
| vanisulfane (CHEBI:760656) has role pesticide (CHEBI:25944) |
| vanisulfane (CHEBI:760656) is a aromatic ether (CHEBI:35618) |
| vanisulfane (CHEBI:760656) is a diol (CHEBI:23824) |
| vanisulfane (CHEBI:760656) is a dithioacetal (CHEBI:59794) |
| vanisulfane (CHEBI:760656) is a monochlorobenzenes (CHEBI:83403) |
| vanisulfane (CHEBI:760656) is a monomethoxybenzene (CHEBI:25235) |
| vanisulfane (CHEBI:760656) is a primary alcohol (CHEBI:15734) |
| IUPAC Name |
|---|
| 2,2'-[({4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl}methylene)bis(sulfanediyl)]di(ethan-1-ol) |
| Synonyms | Source |
|---|---|
| 2,2'-[({4-[(4-chlorobenzyl)oxy]-3-methoxyphenyl}methanediyl)bis(sulfanediyl)]diethanol | IUPAC |
| 2,2′-[[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylene]bis(thio)]bis[ethanol] | Alan Wood's Pesticides |
| 4-[(4-chlorophenyl)methoxy]-3-methoxybenzaldehyde bis(2-hydroxyethyl) dithioacetal | Alan Wood's Pesticides |
| xiangcaoliusuobingmi | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| 3955 | BPDB |
| vanisulfane | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:32062113 | Reaxys |
| CAS:2088490-79-1 | Alan Wood's Pesticides |
| Citations |
|---|