EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H26N6O3 |
| Net Charge | 0 |
| Average Mass | 458.522 |
| Monoisotopic Mass | 458.20664 |
| SMILES | Cc1nn(C)c2cc(-c3noc(C4CCN(C(=O)CNC(=O)c5ccccc5)CC4)n3)ccc12 |
| InChI | InChI=1S/C25H26N6O3/c1-16-20-9-8-19(14-21(20)30(2)28-16)23-27-25(34-29-23)18-10-12-31(13-11-18)22(32)15-26-24(33)17-6-4-3-5-7-17/h3-9,14,18H,10-13,15H2,1-2H3,(H,26,33) |
| InChIKey | UNYSKYOVUXWBJG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 1.14.19.1 (stearoyl-CoA 9-desaturase) inhibitor An EC 1.14.19.* (oxidoreductase acting on paired donors, with incorporation of one atom each of oxygen into both donors, with 2-oxoglutarate as one donor) inhibitor that interferes with the action of stearoyl-CoA 9-desaturase (EC 1.14.19.1). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| YTX-465 (CHEBI:760578) has role EC 1.14.19.1 (stearoyl-CoA 9-desaturase) inhibitor (CHEBI:760800) |
| YTX-465 (CHEBI:760578) is a N-acylpiperidine (CHEBI:48591) |
| YTX-465 (CHEBI:760578) is a 1,2,4-oxadiazole (CHEBI:46809) |
| YTX-465 (CHEBI:760578) is a benzamides (CHEBI:22702) |
| YTX-465 (CHEBI:760578) is a indazoles (CHEBI:38769) |
| YTX-465 (CHEBI:760578) is a secondary carboxamide (CHEBI:140325) |
| YTX-465 (CHEBI:760578) is a tertiary amino compound (CHEBI:50996) |
| YTX-465 (CHEBI:760578) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| N-(2-{4-[3-(1,3-dimethyl-1H-indazol-6-yl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl}-2-oxoethyl)benzamide |
| Synonyms | Source |
|---|---|
| N-[2-[4-[3-(1,3-dimethyl-1H-indazol-6-yl)-1,2,4-oxadiazol-5-yl]-1-piperidinyl]-2-oxoethyl]benzamide | CAS |
| N-(2-(4-(3-(1,3-dimethyl-1H-indazol-6-yl)-1,2,4-oxadiazol-5-yl)piperidin-1-yl)-2-oxoethyl)benzamide | ChEBI |
| N-[2-[4-[3-(1,3-dimethylindazol-6-yl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-2-oxoethyl]benzamide | ChEBI |
| YTX 465 | ChEBI |
| YTX465 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:2225824-53-1 | CAS |
| Citations |
|---|