EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18N4O5S |
| Net Charge | 0 |
| Average Mass | 414.443 |
| Monoisotopic Mass | 414.09979 |
| SMILES | COc1ccccc1S(=O)(=O)Nc1noc2cc(Cn3cccn3)cc(OC)c12 |
| InChI | InChI=1S/C19H18N4O5S/c1-26-14-6-3-4-7-17(14)29(24,25)22-19-18-15(27-2)10-13(11-16(18)28-21-19)12-23-9-5-8-20-23/h3-11H,12H2,1-2H3,(H,21,22) |
| InChIKey | RCBWSTJGOASLEO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prifetrastat (CHEBI:760526) has role antineoplastic agent (CHEBI:35610) |
| prifetrastat (CHEBI:760526) is a sulfonamide (CHEBI:35358) |
| Synonyms | Source |
|---|---|
| PF-07248144 | ChEMBL |
| Prifetrastat | ChEMBL |