EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H6D5NO2 |
| Net Charge | 0 |
| Average Mass | 170.223 |
| Monoisotopic Mass | 170.11036 |
| SMILES | [2H]c1c([2H])c([2H])c(CC(N)C(=O)O)c([2H])c1[2H] |
| InChI | InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/i1D,2D,3D,4D,5D |
| InChIKey | COLNVLDHVKWLRT-RALIUCGRSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenylalanine-d5 (CHEBI:76052) is a deuterated compound (CHEBI:76107) |
| phenylalanine-d5 (CHEBI:76052) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| IUPAC Name |
|---|
| (2,3,4,5,6-H5)phenylalanine |
| Synonym | Source |
|---|---|
| 2,3,4,5,6-pentadeuteriophenylalanine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3965122 | Reaxys |
| CAS:56253-90-8 | Reaxys |