EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H4D5NO4 |
| Net Charge | 0 |
| Average Mass | 152.161 |
| Monoisotopic Mass | 152.08454 |
| SMILES | [2H]C([2H])(C(=O)O)C([2H])([2H])C([2H])(N)C(=O)O |
| InChI | InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/i1D2,2D2,3D |
| InChIKey | WHUUTDBJXJRKMK-UXXIZXEISA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glutamic acid-2,3,3,4,4-d5 (CHEBI:76051) is a deuterated compound (CHEBI:76107) |
| glutamic acid-2,3,3,4,4-d5 (CHEBI:76051) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| IUPAC Name |
|---|
| (2,3,3,4,4-2H5)glutamic acid |
| Synonyms | Source |
|---|---|
| glutamic acid-d5 | ChEBI |
| 2,3,3,4,4-pentadeuterioglutamic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2112178 | Reaxys |