EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H3D4NO2 |
| Net Charge | 0 |
| Average Mass | 93.118 |
| Monoisotopic Mass | 93.07279 |
| SMILES | [2H]C([2H])([2H])[C@]([2H])(N)C(=O)O |
| InChI | InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m0/s1/i1D3,2D |
| InChIKey | QNAYBMKLOCPYGJ-IALWIIEESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-alanine-2,3,3,3-d4 (CHEBI:76050) is a L-α-amino acid (CHEBI:15705) |
| L-alanine-2,3,3,3-d4 (CHEBI:76050) is a alanine (CHEBI:16449) |
| L-alanine-2,3,3,3-d4 (CHEBI:76050) is a deuterated compound (CHEBI:76107) |
| IUPAC Name |
|---|
| L-(2,3,3,3-2H4)alanine |
| Synonyms | Source |
|---|---|
| 2,3,3,3-tetradeuterioL-alanine | ChEBI |
| L-alanine-d4 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11056411 | Reaxys |