EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H4D4O7 |
| Net Charge | 0 |
| Average Mass | 196.147 |
| Monoisotopic Mass | 196.05211 |
| SMILES | [2H]C([2H])(C(=O)O)C(O)(C(=O)O)C([2H])([2H])C(=O)O |
| InChI | InChI=1S/C6H8O7/c7-3(8)1-6(13,5(11)12)2-4(9)10/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/i1D2,2D2 |
| InChIKey | KRKNYBCHXYNGOX-LNLMKGTHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| citric acid-d4 (CHEBI:76049) is a deuterated compound (CHEBI:76107) |
| citric acid-d4 (CHEBI:76049) is a tertiary alcohol (CHEBI:26878) |
| citric acid-d4 (CHEBI:76049) is a tricarboxylic acid (CHEBI:27093) |
| IUPAC Name |
|---|
| 2-hydroxy(2H4)propane-1,2,3-tricarboxylic acid |