EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H31FN8O3 |
| Net Charge | 0 |
| Average Mass | 582.640 |
| Monoisotopic Mass | 582.25032 |
| SMILES | CCOc1cc2ncnc(Nc3ccc(Oc4ccn5ncnc5c4)c(C)c3)c2cc1NC(=O)/C(F)=C/[C@H]1CCCN1C |
| InChI | InChI=1S/C31H31FN8O3/c1-4-42-28-16-25-23(15-26(28)38-31(41)24(32)13-21-6-5-10-39(21)3)30(35-17-33-25)37-20-7-8-27(19(2)12-20)43-22-9-11-40-29(14-22)34-18-36-40/h7-9,11-18,21H,4-6,10H2,1-3H3,(H,38,41)(H,33,35,37)/b24-13-/t21-/m1/s1 |
| InChIKey | HTAMCULFUCGZAM-FKYOTISTSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sph-5030 (CHEBI:760469) has role antineoplastic agent (CHEBI:35610) |
| sph-5030 (CHEBI:760469) is a quinazolines (CHEBI:38530) |
| Synonyms | Source |
|---|---|
| Sph-5030 | ChEMBL |
| Sph5030 | ChEMBL |