EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H32N8O2 |
| Net Charge | 0 |
| Average Mass | 512.618 |
| Monoisotopic Mass | 512.26482 |
| SMILES | CN1CCN(c2ccc(Nc3ncc4c(=O)n5n(c4n3)-c3cccc(n3)[C@](C)(O)CC/C=C\C5)cc2)CC1 |
| InChI | InChI=1S/C28H32N8O2/c1-28(38)13-4-3-5-14-35-26(37)22-19-29-27(32-25(22)36(35)24-8-6-7-23(28)31-24)30-20-9-11-21(12-10-20)34-17-15-33(2)16-18-34/h3,5-12,19,38H,4,13-18H2,1-2H3,(H,29,30,32)/b5-3-/t28-/m1/s1 |
| InChIKey | KSZKLDQYICQTLL-WHQCRVIKSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sc-0191 (CHEBI:760467) has role antineoplastic agent (CHEBI:35610) |
| sc-0191 (CHEBI:760467) is a piperazines (CHEBI:26144) |
| Synonyms | Source |
|---|---|
| Sc-0191 | ChEMBL |
| Sc0191 | ChEMBL |