EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H31ClF3N9O5 |
| Net Charge | 0 |
| Average Mass | 702.094 |
| Monoisotopic Mass | 701.20888 |
| SMILES | CCc1c(N2CCN(C(=O)c3ncnc(C)c3O)CC2)c(=O)n2nc(C3=CCOCC3)nc2n1CC(=O)Nc1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C31H31ClF3N9O5/c1-3-22-25(41-8-10-42(11-9-41)28(47)24-26(46)17(2)36-16-37-24)29(48)44-30(39-27(40-44)18-6-12-49-13-7-18)43(22)15-23(45)38-21-5-4-19(14-20(21)32)31(33,34)35/h4-6,14,16,46H,3,7-13,15H2,1-2H3,(H,38,45) |
| InChIKey | XKYVECRUZPCRQR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hro-761 (CHEBI:760462) has role antineoplastic agent (CHEBI:35610) |
| hro-761 (CHEBI:760462) is a N-arylpiperazine (CHEBI:46848) |
| Synonyms | Source |
|---|---|
| Hro-761 | ChEMBL |
| Hro761 | ChEMBL |