EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H25ClN2O5 |
| Net Charge | 0 |
| Average Mass | 432.904 |
| Monoisotopic Mass | 432.14520 |
| SMILES | [H][C@]12CCC(C)(C)[C@@]1([H])n1cc(C(=O)O)c(=O)cc1-c1nc(Cl)c(OCCCOC)cc12 |
| InChI | InChI=1S/C22H25ClN2O5/c1-22(2)6-5-12-13-9-17(30-8-4-7-29-3)20(23)24-18(13)15-10-16(26)14(21(27)28)11-25(15)19(12)22/h9-12,19H,4-8H2,1-3H3,(H,27,28)/t12-,19+/m1/s1 |
| InChIKey | JFVCUINASNRMTO-BLVKFPJESA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gsk-3965193 (CHEBI:760460) has role anti-HBV agent (CHEBI:64951) |
| gsk-3965193 (CHEBI:760460) is a naphthyridine derivative (CHEBI:73539) |
| Synonyms | Source |
|---|---|
| Gsk-3965193 | ChEMBL |
| Gsk3965193 | ChEMBL |
| GSK3965193B FREE ACID | ChEMBL |