EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11NO4 |
| Net Charge | 0 |
| Average Mass | 197.190 |
| Monoisotopic Mass | 197.06881 |
| SMILES | C[C@@H](C(=O)[O-])[n+]1cc(O)ccc1CO |
| InChI | InChI=1S/C9H11NO4/c1-6(9(13)14)10-4-8(12)3-2-7(10)5-11/h2-4,6,11H,5H2,1H3,(H-,12,13,14)/t6-/m0/s1 |
| InChIKey | IGOUMBTVEMUDSU-LURJTMIESA-N |
| Roles Classification |
|---|
| Biological Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-(S)-alapyridaine (CHEBI:76046) has functional parent L-alanine (CHEBI:16977) |
| (+)-(S)-alapyridaine (CHEBI:76046) has role flavouring agent (CHEBI:35617) |
| (+)-(S)-alapyridaine (CHEBI:76046) is a iminium betaine (CHEBI:35285) |
| IUPAC Name |
|---|
| (2S)-2-[5-hydroxy-2-(hydroxymethyl)pyridinium-1-yl]propanoate |
| Synonyms | Source |
|---|---|
| N-(1-carboxyethyl)-6-hydroxymethyl-pyridinium-3-ol | SUBMITTER |
| (S)-alapyridaine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9553168 | Reaxys |
| Citations |
|---|