EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H35FN8O2 |
| Net Charge | 0 |
| Average Mass | 570.673 |
| Monoisotopic Mass | 570.28670 |
| SMILES | [H][C@@]12CCC[C@]1([H])[C@@H](C(=O)N1CCC3(CC1)CN(c1ncnnc1Oc1ccc(F)cc1-c1cncnc1C1CC1)C3)NC2 |
| InChI | InChI=1S/C31H35FN8O2/c32-21-6-7-25(23(12-21)24-14-33-17-35-26(24)19-4-5-19)42-29-28(36-18-37-38-29)40-15-31(16-40)8-10-39(11-9-31)30(41)27-22-3-1-2-20(22)13-34-27/h6-7,12,14,17-20,22,27,34H,1-5,8-11,13,15-16H2/t20-,22-,27-/m0/s1 |
| InChIKey | XDXAYPYOHXUEAM-CLHVYKLBSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bn-104 (CHEBI:760453) has role antineoplastic agent (CHEBI:35610) |
| bn-104 (CHEBI:760453) is a amino acid amide (CHEBI:22475) |
| Synonyms | Source |
|---|---|
| Bn-104 | ChEMBL |
| Bn104 | ChEMBL |