EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H32ClN7O2 |
| Net Charge | 0 |
| Average Mass | 546.075 |
| Monoisotopic Mass | 545.23060 |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc(Cl)c(Nc3ccc4ccccc4c3)n2)c(OC)cc1N(C)CCN(C)C |
| InChI | InChI=1S/C29H32ClN7O2/c1-6-27(38)33-23-16-24(26(39-5)17-25(23)37(4)14-13-36(2)3)34-29-31-18-22(30)28(35-29)32-21-12-11-19-9-7-8-10-20(19)15-21/h6-12,15-18H,1,13-14H2,2-5H3,(H,33,38)(H2,31,32,34,35) |
| InChIKey | QHPVTCLSVVUPOF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ask-120067 (CHEBI:760444) has role antineoplastic agent (CHEBI:35610) |
| ask-120067 (CHEBI:760444) is a naphthalenes (CHEBI:25477) |
| Synonyms | Source |
|---|---|
| Ask-120067 | ChEMBL |
| Ask120067 | ChEMBL |