EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30N6O4 |
| Net Charge | 0 |
| Average Mass | 466.542 |
| Monoisotopic Mass | 466.23285 |
| SMILES | Cc1cn(C)nc1[C@H](Nc1c(Nc2ccnc(C(=O)N(C)C)c2O)c(=O)c1=O)C1(C)CCCC1 |
| InChI | InChI=1S/C24H30N6O4/c1-13-12-30(5)28-15(13)22(24(2)9-6-7-10-24)27-17-16(20(32)21(17)33)26-14-8-11-25-18(19(14)31)23(34)29(3)4/h8,11-12,22,27,31H,6-7,9-10H2,1-5H3,(H,25,26)/t22-/m0/s1 |
| InChIKey | WZBSYWCLIMRAHO-QFIPXVFZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pf-07054894 (CHEBI:760428) has role anti-inflammatory agent (CHEBI:67079) |
| pf-07054894 (CHEBI:760428) is a aromatic carboxylic acid (CHEBI:33859) |
| pf-07054894 (CHEBI:760428) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| Synonym | Source |
|---|---|
| Pf-07054894 | ChEMBL |