EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H21F3N4 |
| Net Charge | 0 |
| Average Mass | 374.410 |
| Monoisotopic Mass | 374.17183 |
| SMILES | CN(c1ccc(C#N)c(C(F)(F)F)c1)[C@@H]1C=C(n2ccnc2)CCC1(C)C |
| InChI | InChI=1S/C20H21F3N4/c1-19(2)7-6-16(27-9-8-25-13-27)11-18(19)26(3)15-5-4-14(12-24)17(10-15)20(21,22)23/h4-5,8-11,13,18H,6-7H2,1-3H3/t18-/m1/s1 |
| InChIKey | CIGRGLYYGIMTOD-GOSISDBHSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| odm-204 (CHEBI:760425) has role antineoplastic agent (CHEBI:35610) |
| odm-204 (CHEBI:760425) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| Synonym | Source |
|---|---|
| Odm-204 | ChEMBL |