EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2F3O2.C51H67N4O9S2 |
| Net Charge | 0 |
| Average Mass | 1057.264 |
| Monoisotopic Mass | 1056.41999 |
| SMILES | CC1(C)C(=CC=C2CCCC(C=CC3=[N+](CCC[N+](C)(C)C)c4ccc(S(=O)(=O)[O-])cc4C3(C)C)=C2Oc2ccc(CCC(=O)O)cc2)N(CCC[N+](C)(C)C)c2ccc(S(=O)(=O)[O-])cc21.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C51H66N4O9S2.C2HF3O2/c1-50(2)42-34-40(65(58,59)60)23-25-44(42)52(30-12-32-54(5,6)7)46(50)27-19-37-14-11-15-38(49(37)64-39-21-16-36(17-22-39)18-29-48(56)57)20-28-47-51(3,4)43-35-41(66(61,62)63)24-26-45(43)53(47)31-13-33-55(8,9)10;3-2(4,5)1(6)7/h16-17,19-28,34-35H,11-15,18,29-33H2,1-10H3;(H,6,7) |
| InChIKey | BBCIVAMITUFAHW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | vulnerary A drug used in treating and healing of wounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nizaracianine triflutate (CHEBI:760424) has role vulnerary (CHEBI:73336) |
| nizaracianine triflutate (CHEBI:760424) is a benzenes (CHEBI:22712) |
| nizaracianine triflutate (CHEBI:760424) is a monocarboxylic acid (CHEBI:25384) |
| Synonym | Source |
|---|---|
| Nizaracianine triflutate | ChEMBL |