EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H29F4N5O2.HCl |
| Net Charge | 0 |
| Average Mass | 604.048 |
| Monoisotopic Mass | 603.20242 |
| SMILES | CN(C)C(=O)/C=C/CNCCOc1ccc(/C(=C(/CC(F)(F)F)c2ccccc2)c2ccc3nnc(F)c3c2)cn1.Cl |
| InChI | InChI=1S/C30H29F4N5O2.ClH/c1-39(2)27(40)9-6-14-35-15-16-41-26-13-11-22(19-36-26)28(21-10-12-25-23(17-21)29(31)38-37-25)24(18-30(32,33)34)20-7-4-3-5-8-20;/h3-13,17,19,35H,14-16,18H2,1-2H3,(H,37,38);1H/b9-6+,28-24-; |
| InChIKey | KNSVJVMDHBDKJL-XVBKFJSKSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| h3b-6545 (CHEBI:760423) has role antineoplastic agent (CHEBI:35610) |
| h3b-6545 (CHEBI:760423) is a stilbenoid (CHEBI:26776) |
| Synonyms | Source |
|---|---|
| H3b 6545 | ChEMBL |
| H3b-6545 | ChEMBL |