EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H10F2N2O3S |
| Net Charge | 0 |
| Average Mass | 360.341 |
| Monoisotopic Mass | 360.03802 |
| SMILES | CS(=O)(=O)c1ccc(C#N)cc1-c1cc(=O)c2c(F)cc(F)cc2n1 |
| InChI | InChI=1S/C17H10F2N2O3S/c1-25(23,24)16-3-2-9(8-20)4-11(16)13-7-15(22)17-12(19)5-10(18)6-14(17)21-13/h2-7H,1H3,(H,21,22) |
| InChIKey | RBUBBZVQPHSZEZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fx-909 (CHEBI:760421) has role antineoplastic agent (CHEBI:35610) |
| fx-909 (CHEBI:760421) is a quinolines (CHEBI:26513) |
| Synonyms | Source |
|---|---|
| Fx-909 | ChEMBL |
| FX909 | ChEMBL |