EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:760417 - arginine aspartate
| Formula | C6H14N4O2.C4H7NO4 |
| Net Charge | 0 |
| Average Mass | 307.307 |
| Monoisotopic Mass | 307.14918 |
| SMILES | N=C(N)NCCC[C@H](N)C(=O)O.N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H14N4O2.C4H7NO4/c7-4(5(11)12)2-1-3-10-6(8)9;5-2(4(8)9)1-3(6)7/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);2H,1,5H2,(H,6,7)(H,8,9)/t4-;2-/m00/s1 |
| InChIKey | SUUWYOYAXFUOLX-ZBRNBAAYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arginine aspartate (CHEBI:760417) is a arginine derivative (CHEBI:22617) |
| Synonyms | Source |
|---|---|
| Arginine aspartate | ChEMBL |
| Arginine l-aspartate | ChEMBL |
| Arginine, l-, l-aspartate (1:1) | ChEMBL |
| Aspartic acid compound with l-arginine | ChEMBL |
| Sargenor | ChEMBL |
| Targifor | ChEMBL |