EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H43N3O4 |
| Net Charge | 0 |
| Average Mass | 545.724 |
| Monoisotopic Mass | 545.32536 |
| SMILES | [H][C@]12CC[C@]([H])(C=C1c1ccccc1)[C@@](CCN(C)CCCc1nc3c(OC)ccc(OC)c3n1)(OC(=O)C(C)C)C2 |
| InChI | InChI=1S/C33H43N3O4/c1-22(2)32(37)40-33(21-24-13-14-25(33)20-26(24)23-10-7-6-8-11-23)17-19-36(3)18-9-12-29-34-30-27(38-4)15-16-28(39-5)31(30)35-29/h6-8,10-11,15-16,20,22,24-25H,9,12-14,17-19,21H2,1-5H3,(H,34,35)/t24-,25-,33+/m1/s1 |
| InChIKey | PEBSFLONQDNKQK-PHLCOOFXSA-N |
| Roles Classification |
|---|
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| act-280778 (CHEBI:760413) has role antihypertensive agent (CHEBI:35674) |
| act-280778 (CHEBI:760413) is a benzimidazoles (CHEBI:22715) |
| Synonyms | Source |
|---|---|
| ACS-280778 | ChEMBL |
| Act-280778 | ChEMBL |