EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O5 |
| Net Charge | 0 |
| Average Mass | 164.157 |
| Monoisotopic Mass | 164.06847 |
| SMILES | [H][C@]1([C@@H](C)O)OC(O)[C@@H](O)[C@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a1122m-1x_1-4]/1/ |
| InChI | InChI=1S/C6H12O5/c1-2(7)5-3(8)4(9)6(10)11-5/h2-10H,1H3/t2-,3-,4+,5-,6?/m1/s1 |
| InChIKey | AFNUZVCFKQUDBJ-GASJEMHNSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-rhamnofuranose (CHEBI:76039) is a D-rhamnose (CHEBI:63150) |
| Incoming Relation(s) |
| α-D-rhamnofuranose (CHEBI:75862) is a D-rhamnofuranose (CHEBI:76039) |
| β-D-rhamnofuranose (CHEBI:76038) is a D-rhamnofuranose (CHEBI:76039) |
| IUPAC Name |
|---|
| 6-deoxy-D-mannofuranose |