EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H2O.C30H34N8O3.CH4O3S |
| Net Charge | 0 |
| Average Mass | 668.777 |
| Monoisotopic Mass | 668.27407 |
| SMILES | C=CC(=O)Nc1cc(Nc2nccc(-n3cc(CN(C)C)c(-c4ccccc4)n3)n2)c(OC)cc1N1CCOCC1.CS(=O)(=O)O.O |
| InChI | InChI=1S/C30H34N8O3.CH4O3S.H2O/c1-5-28(39)32-23-17-24(26(40-4)18-25(23)37-13-15-41-16-14-37)33-30-31-12-11-27(34-30)38-20-22(19-36(2)3)29(35-38)21-9-7-6-8-10-21;1-5(2,3)4;/h5-12,17-18,20H,1,13-16,19H2,2-4H3,(H,32,39)(H,31,33,34);1H3,(H,2,3,4);1H2 |
| InChIKey | ZJPNGZUERUYZEG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lazertinib mesylate (CHEBI:760389) has role antineoplastic agent (CHEBI:35610) |
| lazertinib mesylate (CHEBI:760389) is a morpholines (CHEBI:38785) |
| Synonyms | Source |
|---|---|
| JNJ-73841937-ZCY | ChEMBL |
| Lazcluze | ChEMBL |
| Lazertinib mesilate hydrate | ChEMBL |
| Lazertinib mesylate | ChEMBL |
| Lazertinib mesylate monohydrate | ChEMBL |
| R-605024 | ChEMBL |
| Brand Name | Source |
|---|---|
| Leclaza | ChEMBL |