EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C58H89NO14 |
| Net Charge | 0 |
| Average Mass | 1024.343 |
| Monoisotopic Mass | 1023.62831 |
| SMILES | [H][C@@]12CC[C@@H](C)[C@@](O)(O1)C(=O)C(=O)N1CCCC[C@@]1([H])C(=O)O[C@]([H])([C@H](C)C[C@@H]1CC[C@@H](OC(=O)C3CCCCC3)[C@H](OC)C1)CC(=O)[C@H](C)/C=C(\C)[C@@H](O)[C@@H](OC)C(=O)[C@H](C)C[C@H](C)/C=C/C=C/C=C(\C)[C@@H](OC)C2 |
| InChI | InChI=1S/C58H89NO14/c1-35-19-13-11-14-20-36(2)48(68-8)33-44-26-24-41(7)58(67,73-44)54(63)55(64)59-28-18-17-23-45(59)57(66)72-49(34-46(60)37(3)30-40(6)52(62)53(70-10)51(61)39(5)29-35)38(4)31-42-25-27-47(50(32-42)69-9)71-56(65)43-21-15-12-16-22-43/h11,13-14,19-20,30,35,37-39,41-45,47-50,52-53,62,67H,12,15-18,21-29,31-34H2,1-10H3/b14-11+,19-13+,36-20+,40-30+/t35-,37-,38-,39-,41-,42+,44+,45+,47-,48+,49+,50-,52-,53+,58-/m1/s1 |
| InChIKey | CFHQWCVHPJFPBS-IMPNTQJQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| laporolimus (CHEBI:760388) has role antineoplastic agent (CHEBI:35610) |
| laporolimus (CHEBI:760388) is a peptide (CHEBI:16670) |
| Synonyms | Source |
|---|---|
| CRC-015 | ChEMBL |
| Laporolimus | ChEMBL |
| Brand Name | Source |
|---|---|
| Biotorcin | ChEMBL |