EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H48O3 |
| Net Charge | 0 |
| Average Mass | 384.645 |
| Monoisotopic Mass | 384.36035 |
| SMILES | CCCCCCCCCCCCCCCCCCCCCC[C@@H](O)C(=O)O |
| InChI | InChI=1S/C24H48O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(25)24(26)27/h23,25H,2-22H2,1H3,(H,26,27)/t23-/m1/s1 |
| InChIKey | MSUOLNSQHLHDAS-HSZRJFAPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-2-hydroxylignoceric acid (CHEBI:76036) has functional parent tetracosanoic acid (CHEBI:28866) |
| (R)-2-hydroxylignoceric acid (CHEBI:76036) is a 2-hydroxy fatty acid (CHEBI:10283) |
| (R)-2-hydroxylignoceric acid (CHEBI:76036) is a very long-chain fatty acid (CHEBI:27283) |
| (R)-2-hydroxylignoceric acid (CHEBI:76036) is conjugate acid of (R)-2-hydroxylignocerate (CHEBI:75935) |
| Incoming Relation(s) |
| 1-(3-O-sulfo-β-D-galactosyl)-N-[(2R)-2-hydroxylignoceroyl]sphingosine (CHEBI:76069) has functional parent (R)-2-hydroxylignoceric acid (CHEBI:76036) |
| 1-(β-D-galactosyl)-N-[(2R)-2-hydroxylignoceroyl]sphingosine (CHEBI:75966) has functional parent (R)-2-hydroxylignoceric acid (CHEBI:76036) |
| (R)-2-hydroxylignocerate (CHEBI:75935) is conjugate base of (R)-2-hydroxylignoceric acid (CHEBI:76036) |
| IUPAC Name |
|---|
| (2R)-2-hydroxytetracosanoic acid |
| Synonyms | Source |
|---|---|
| (R)-2-hydroxytetracosanoic acid | ChEBI |
| D-Cerebronic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050321 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1728967 | Reaxys |