EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H2O.C22H24N6O3.HCl |
| Net Charge | 0 |
| Average Mass | 474.949 |
| Monoisotopic Mass | 474.17823 |
| SMILES | Cc1nc(NC(=O)N2CCC(C)(C)C2=O)ccc1Oc1ccnc(-c2cnn(C)c2)c1.Cl.O |
| InChI | InChI=1S/C22H24N6O3.ClH.H2O/c1-14-18(31-16-7-9-23-17(11-16)15-12-24-27(4)13-15)5-6-19(25-14)26-21(30)28-10-8-22(2,3)20(28)29;;/h5-7,9,11-13H,8,10H2,1-4H3,(H,25,26,30);1H;1H2 |
| InChIKey | QZLRVUSCDKEPQY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pimicotinib hydrochloride (CHEBI:760344) has role anti-inflammatory agent (CHEBI:67079) |
| pimicotinib hydrochloride (CHEBI:760344) has role antineoplastic agent (CHEBI:35610) |
| pimicotinib hydrochloride (CHEBI:760344) is a pyrazolopyridine (CHEBI:46699) |
| Synonyms | Source |
|---|---|
| Absk 021 | ChEMBL |
| ABSK-021 | ChEMBL |
| ABSK021 | ChEMBL |
| ABSK-021-0 | ChEMBL |
| ASYM-132018 | ChEMBL |
| Pimicotinib hydrochloride | ChEMBL |