EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C49H70N4O5S.C7H8O3S |
| Net Charge | 0 |
| Average Mass | 999.394 |
| Monoisotopic Mass | 998.52611 |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.[H][C@]12CC[C@@]3([H])[C@@](C)(CC[C@@]4(NCCN5CCS(=O)(=O)CC5)CC[C@@H](C(=C)C)[C@@]43[H])[C@]1(C)CC[C@@]1([H])C(C)(C)C(C3=CC[C@@](COc4ncccc4C#N)(C(=O)O)CC3)=CC[C@]21C |
| InChI | InChI=1S/C49H70N4O5S.C7H8O3S/c1-33(2)36-14-21-49(52-25-26-53-27-29-59(56,57)30-28-53)23-22-46(6)38(41(36)49)10-11-40-45(5)17-15-37(44(3,4)39(45)16-18-47(40,46)7)34-12-19-48(20-13-34,43(54)55)32-58-42-35(31-50)9-8-24-51-42;1-6-2-4-7(5-3-6)11(8,9)10/h8-9,12,15,24,36,38-41,52H,1,10-11,13-14,16-23,25-30,32H2,2-7H3,(H,54,55);2-5H,1H3,(H,8,9,10)/t36-,38+,39-,40+,41+,45-,46+,47+,48+,49-;/m0./s1 |
| InChIKey | SEHZJXUCYMLELM-JREOKXOLSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zegruvirimat tosylate (CHEBI:760341) has role anti-HIV agent (CHEBI:64946) |
| zegruvirimat tosylate (CHEBI:760341) is a triterpenoid (CHEBI:36615) |
| Synonyms | Source |
|---|---|
| GSK-3739937G | ChEMBL |
| GSK3739937G | ChEMBL |
| GSK3739937 tosylate | ChEMBL |
| GSK-3739937 TOSYLATE | ChEMBL |
| VH3739937 tosylate | ChEMBL |
| VH-3739937 TOSYLATE | ChEMBL |