EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H4O2.C24H30N6O3S |
| Net Charge | 0 |
| Average Mass | 542.662 |
| Monoisotopic Mass | 542.23114 |
| SMILES | CC(=O)O.CS(=O)(=O)N1CCC(c2ccc(-c3ncc4nccnc4c3NC[C@@H]3CNCCO3)cc2)CC1 |
| InChI | InChI=1S/C24H30N6O3S.C2H4O2/c1-34(31,32)30-11-6-18(7-12-30)17-2-4-19(5-3-17)22-24(28-15-20-14-25-10-13-33-20)23-21(16-29-22)26-8-9-27-23;1-2(3)4/h2-5,8-9,16,18,20,25,28H,6-7,10-15H2,1H3;1H3,(H,3,4)/t20-;/m0./s1 |
| InChIKey | BLXFQSAPWJZZEP-BDQAORGHSA-N |
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sovleplenib acetate (CHEBI:760340) has role anti-inflammatory agent (CHEBI:67079) |
| sovleplenib acetate (CHEBI:760340) has role antineoplastic agent (CHEBI:35610) |
| sovleplenib acetate (CHEBI:760340) is a piperidines (CHEBI:26151) |
| Synonyms | Source |
|---|---|
| HMPL-523 Acetate | ChEMBL |
| Sovleplenib acetate | ChEMBL |