EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H15Cl2F2N5O3S |
| Net Charge | 0 |
| Average Mass | 490.319 |
| Monoisotopic Mass | 489.02407 |
| SMILES | Cn1cnc2ccc(Nc3c(F)ccc(NS(=O)(=O)N4CC(F)C4)c3Cl)c(Cl)c2c1=O |
| InChI | InChI=1S/C18H15Cl2F2N5O3S/c1-26-8-23-11-4-5-12(15(19)14(11)18(26)28)24-17-10(22)2-3-13(16(17)20)25-31(29,30)27-6-9(21)7-27/h2-5,8-9,24-25H,6-7H2,1H3 |
| InChIKey | SHENFUUACGRLOZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| claturafenib (CHEBI:760336) has role antineoplastic agent (CHEBI:35610) |
| claturafenib (CHEBI:760336) is a quinazolines (CHEBI:38530) |
| Synonyms | Source |
|---|---|
| ARRY-440 | ChEMBL |
| Claturafenib | ChEMBL |
| PF-07799933 | ChEMBL |