EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14ClN3O6S |
| Net Charge | 0 |
| Average Mass | 351.768 |
| Monoisotopic Mass | 351.02918 |
| SMILES | Cc1c(Cl)cc(S(=O)(=O)O)cc1NC(=O)NC[C@H](N)C(=O)O |
| InChI | InChI=1S/C11H14ClN3O6S/c1-5-7(12)2-6(22(19,20)21)3-9(5)15-11(18)14-4-8(13)10(16)17/h2-3,8H,4,13H2,1H3,(H,16,17)(H2,14,15,18)(H,19,20,21)/t8-/m0/s1 |
| InChIKey | LHEYGVSDVBEYQF-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Application: | renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| upacicalcet (CHEBI:760333) has role renoprotective agent (CHEBI:231911) |
| upacicalcet (CHEBI:760333) is a benzenesulfonates (CHEBI:53348) |
| Synonyms | Source |
|---|---|
| AJT-240 | ChEMBL |
| AJT240 | ChEMBL |
| PLS-240 | ChEMBL |
| PLS240 | ChEMBL |
| SK-1403 | ChEMBL |
| Upacicalcet | ChEMBL |
| Brand Name | Source |
|---|---|
| Upasita | ChEMBL |